Compound Q&A

How is methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) typically synthesized?

Answer

Methyl 2-amino-3-(trifluoromethyl)benzoate
Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) is synthesized through the reaction of 2-amino-3-(trifluoromethyl)benzoic acid with methyl alcohol in the presence of an acid catalyst. The reaction is typically carried out at room temperature, leading to good yield and selectivity. Care must be taken to handle the acid catalyst and the resulting product safely.

About

CAS No 64321-95-5
English Name Methyl 2-amino-3-(trifluoromethyl)benzoate
Molecular Formula C9H8F3NO2
Molecular Weight 219.16 g/mol
SMILES COC(=O)C1=C(C(=CC=C1)C(F)(F)F)N
InChIKey COTQUWGKILPGMY-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5)?

Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) is a crystalline compound with a molecu...

Compound Q&A

What industries use methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5)?

Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) is used in various industries, includin...

Compound Q&A

What precautions should be taken when handling methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5)?

When handling methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...