Compound Q&A

What are the physical and chemical properties of Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5)?

Answer

Methyl 2-amino-3-(trifluoromethyl)benzoate
Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) is a crystalline compound with a molecular weight of approximately 269.13 g/mol. It has a low water solubility and moderate solubility in organic solvents. This compound is highly reactive due to the presence of a trifluoromethyl group and an amino group, which can participate in various chemical reactions.

About

CAS No 64321-95-5
English Name Methyl 2-amino-3-(trifluoromethyl)benzoate
Molecular Formula C9H8F3NO2
Molecular Weight 219.16 g/mol
SMILES COC(=O)C1=C(C(=CC=C1)C(F)(F)F)N
InChIKey COTQUWGKILPGMY-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

How is methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) typically synthesized?

Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) is synthesized through the reaction of ...

Compound Q&A

What industries use methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5)?

Methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5) is used in various industries, includin...

Compound Q&A

What precautions should be taken when handling methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5)?

When handling methyl 2-amino-3-(trifluoromethyl)benzoate (CAS: 64321-95-5), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...