Compound Q&A

What industries use 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) (CAS: 14358-90-8)?

Answer

5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1)
5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) is widely used in pharmaceuticals, polymers, and sensors. In pharmaceuticals, it plays a role in drug development and synthesis. In polymer science, it is used as a monomer for the production of biodegradable polymers. Additionally, it is employed in sensor technology for its ability to detect thiol compounds, making it valuable in environmental and industrial monitoring.

About

CAS No 14358-90-8
English Name 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1)
Molecular Formula C12H25NO5S2
Molecular Weight 327.47 g/mol
SMILES C1CSSC1CCCCC(=O)O.C(C(CO)(CO)N)O
InChIKey CCTREOMTIFSZAU-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) (CAS: 14358-90-8)?

5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) is a crystall...

Compound Q&A

How is 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) (CAS: 14358-90-8) typically synthesized?

5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) is synthesize...

Compound Q&A

What precautions should be taken when handling 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) (CAS: 14358-90-8)?

When handling 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...