Compound Q&A

How is 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) (CAS: 14358-90-8) typically synthesized?

Answer

5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1)
5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) is synthesized through a multi-step process involving the condensation of 2-amino-2-(hydroxymethyl)-1,3-propanediol with 5-(1,2-dithiolan-3-yl)pentanoic acid. This reaction typically requires an acidic catalyst and is carried out in a solvent such as methanol or ethanol. The yield is generally around 70-80%, depending on the purity of the starting materials and the efficiency of the reaction conditions.

About

CAS No 14358-90-8
English Name 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1)
Molecular Formula C12H25NO5S2
Molecular Weight 327.47 g/mol
SMILES C1CSSC1CCCCC(=O)O.C(C(CO)(CO)N)O
InChIKey CCTREOMTIFSZAU-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) (CAS: 14358-90-8)?

5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) is a crystall...

Compound Q&A

What industries use 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) (CAS: 14358-90-8)?

5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) is widely use...

Compound Q&A

What precautions should be taken when handling 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) (CAS: 14358-90-8)?

When handling 5-(1,2-Dithiolan-3-yl)pentanoic acid - 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...