Compound Q&A

What industries use Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8)?

Answer

Methyl 5-bromo-2-(trifluoromethoxy)benzoate
Methyl 5-bromo-2-(trifluoromethoxy)benzoate is primarily used in the pharmaceutical and chemical synthesis industries. It serves as an intermediate in the synthesis of various drugs and other chemical compounds. Additionally, it may have applications in polymer chemistry, where its bromine and trifluoromethoxy groups can influence the properties of polymers.

About

English Name Methyl 5-bromo-2-(trifluoromethoxy)benzoate
Molecular Formula C9H6BrF3O3
Molecular Weight 299.04 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)OC(F)(F)F
InChIKey RLAXIDPRPKZATK-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8)?

Methyl 5-bromo-2-(trifluoromethoxy)benzoate is a crystalline compound with a molecular weight of app...

Compound Q&A

How is Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8) typically synthesized?

Methyl 5-bromo-2-(trifluoromethoxy)benzoate can be synthesized by bromination of methyl 2-(trifluoro...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8)?

When handling Methyl 5-bromo-2-(trifluoromethoxy)benzoate, it is crucial to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...