Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8)?

Answer

Methyl 5-bromo-2-(trifluoromethoxy)benzoate
Methyl 5-bromo-2-(trifluoromethoxy)benzoate is a crystalline compound with a molecular weight of approximately 304.02 g/mol. It has low solubility in water but good solubility in common organic solvents like dichloromethane and acetone. The compound shows limited reactivity under standard conditions but can undergo nucleophilic substitution reactions due to the presence of the bromine and trifluoromethoxy groups.

About

English Name Methyl 5-bromo-2-(trifluoromethoxy)benzoate
Molecular Formula C9H6BrF3O3
Molecular Weight 299.04 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)OC(F)(F)F
InChIKey RLAXIDPRPKZATK-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

How is Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8) typically synthesized?

Methyl 5-bromo-2-(trifluoromethoxy)benzoate can be synthesized by bromination of methyl 2-(trifluoro...

Compound Q&A

What industries use Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8)?

Methyl 5-bromo-2-(trifluoromethoxy)benzoate is primarily used in the pharmaceutical and chemical syn...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8)?

When handling Methyl 5-bromo-2-(trifluoromethoxy)benzoate, it is crucial to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...