Compound Q&A

How is Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8) typically synthesized?

Answer

Methyl 5-bromo-2-(trifluoromethoxy)benzoate
Methyl 5-bromo-2-(trifluoromethoxy)benzoate can be synthesized by bromination of methyl 2-(trifluoromethoxy)benzoate using bromine in the presence of a suitable base such as sodium tert-butylate. The reaction is carried out in a solvent like acetonitrile at room temperature. The yield is typically high, and the reaction is selective for the bromination of the phenolic hydroxyl group.

About

English Name Methyl 5-bromo-2-(trifluoromethoxy)benzoate
Molecular Formula C9H6BrF3O3
Molecular Weight 299.04 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)OC(F)(F)F
InChIKey RLAXIDPRPKZATK-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8)?

Methyl 5-bromo-2-(trifluoromethoxy)benzoate is a crystalline compound with a molecular weight of app...

Compound Q&A

What industries use Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8)?

Methyl 5-bromo-2-(trifluoromethoxy)benzoate is primarily used in the pharmaceutical and chemical syn...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS: 773874-13-8)?

When handling Methyl 5-bromo-2-(trifluoromethoxy)benzoate, it is crucial to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...