Compound Q&A

What industries use (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid (CAS: 73150-67-1)?

Answer

(2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid
(2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid is primarily used in the pharmaceutical industry for the synthesis of various drugs. It also finds applications in the polymer industry for the modification of polymer properties. Additionally, it is used in the development of sensors and as a component in certain chemical reagents.

About

CAS No 73150-67-1
English Name (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid
Molecular Formula C5H4N2O3S
Molecular Weight 172.16 g/mol
SMILES C1=C(N=C(S1)N)C(=O)C(=O)O
InChIKey VMASTYPGLHRVNL-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid (CAS: 73150-67-1)?

(2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid has a crystalline form and a molecular weight of approxim...

Compound Q&A

How is (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid (CAS: 73150-67-1) typically synthesized?

(2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid can be synthesized through the condensation of 2-aminothi...

Compound Q&A

What precautions should be taken when handling (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid (CAS: 73150-67-1)?

When handling (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...