Compound Q&A

How is (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid (CAS: 73150-67-1) typically synthesized?

Answer

(2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid
(2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid can be synthesized through the condensation of 2-aminothiazole-4-carboxylic acid and a suitable aldehyde or ketone. Common methods include the use of a dehydrating agent like hydroxylamine or an acid catalyst. The yield is generally moderate, and the product can be purified by recrystallization or column chromatography.

About

CAS No 73150-67-1
English Name (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid
Molecular Formula C5H4N2O3S
Molecular Weight 172.16 g/mol
SMILES C1=C(N=C(S1)N)C(=O)C(=O)O
InChIKey VMASTYPGLHRVNL-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid (CAS: 73150-67-1)?

(2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid has a crystalline form and a molecular weight of approxim...

Compound Q&A

What industries use (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid (CAS: 73150-67-1)?

(2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid is primarily used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid (CAS: 73150-67-1)?

When handling (2-Amino-1,3-thiazol-4-yl)(oxo)acetic acid, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...