Compound Q&A

What precautions should be taken when handling 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5)?

Answer

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate
When handling 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Store the compound in a fume hood to minimize exposure to fumes. In case of spills, immediately clean them up using appropriate absorbents and follow the safety data sheet (SDS) for disposal. Always ensure proper ventilation and follow all laboratory safety protocols.

About

CAS No 59219-71-5
English Name 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate
Molecular Formula C18H36O2
Molecular Weight 284.48 g/mol
SMILES CC(CCOC(=O)CC(C)CC(C)(C)C)CC(C)(C)C
InChIKey UIVPNOBLHXUKDX-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5)?

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) is a colorless to light yellow liqui...

Compound Q&A

How is 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) typically synthesized?

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) is typically synthesized through est...

Compound Q&A

What industries use 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5)?

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) is used in the pharmaceutical, polym...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...