Compound Q&A

What are the physical and chemical properties of 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5)?

Answer

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate
3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) is a colorless to light yellow liquid with a high boiling point and good solubility in organic solvents. It has a molecular weight of approximately 290.42 and is relatively stable under normal conditions. It exhibits low reactivity, making it suitable for various applications without degrading easily.

About

CAS No 59219-71-5
English Name 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate
Molecular Formula C18H36O2
Molecular Weight 284.48 g/mol
SMILES CC(CCOC(=O)CC(C)CC(C)(C)C)CC(C)(C)C
InChIKey UIVPNOBLHXUKDX-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

How is 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) typically synthesized?

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) is typically synthesized through est...

Compound Q&A

What industries use 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5)?

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) is used in the pharmaceutical, polym...

Compound Q&A

What precautions should be taken when handling 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5)?

When handling 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...