Compound Q&A

What industries use 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5)?

Answer

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate
3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) is used in the pharmaceutical, polymer, and sensor industries for its unique chemical properties. It serves as a raw material for the synthesis of pharmaceuticals, enhances the performance of polymers, and is also used in the development of chemical sensors due to its stability and reactivity.

About

CAS No 59219-71-5
English Name 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate
Molecular Formula C18H36O2
Molecular Weight 284.48 g/mol
SMILES CC(CCOC(=O)CC(C)CC(C)(C)C)CC(C)(C)C
InChIKey UIVPNOBLHXUKDX-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5)?

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) is a colorless to light yellow liqui...

Compound Q&A

How is 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) typically synthesized?

3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5) is typically synthesized through est...

Compound Q&A

What precautions should be taken when handling 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5)?

When handling 3,5,5-Trimethylhexyl 3,5,5-trimethylhexanoate (CAS: 59219-71-5), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...