Compound Q&A

What precautions should be taken when handling 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4)?

Answer

5-Bromo-6-chloro-1H-indol-3-yl octanoate
When handling 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4), use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to avoid inhalation. Store the compound in a cool, dry place away from direct sunlight. In case of a spill, clean up immediately using appropriate absorbent materials and follow safety data sheet (SDS) guidelines for disposal.

About

English Name 5-Bromo-6-chloro-1H-indol-3-yl octanoate
Molecular Formula C16H19BrClNO2
Molecular Weight 372.69 g/mol
SMILES CCCCCCCC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl
InChIKey HODNRFUPDHGKHG-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4)?

5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4) has a crystalline form and a molecular w...

Compound Q&A

How is 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4) typically synthesized?

5-Bromo-6-chloro-1H-indol-3-yl octanoate is typically synthesized by reacting 5-bromo-6-chloro-1H-in...

Compound Q&A

What industries use 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4)?

5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4) is primarily used in the pharmaceutical ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...