Compound Q&A

What are the physical and chemical properties of 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4)?

Answer

5-Bromo-6-chloro-1H-indol-3-yl octanoate
5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4) has a crystalline form and a molecular weight of approximately 383.12 g/mol. It is slightly soluble in water and has good solubility in organic solvents such as ethanol and acetone. The compound is chemically stable but may react with strong oxidizing agents. It is not flammable and has a low reactivity under normal conditions.

About

English Name 5-Bromo-6-chloro-1H-indol-3-yl octanoate
Molecular Formula C16H19BrClNO2
Molecular Weight 372.69 g/mol
SMILES CCCCCCCC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl
InChIKey HODNRFUPDHGKHG-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

How is 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4) typically synthesized?

5-Bromo-6-chloro-1H-indol-3-yl octanoate is typically synthesized by reacting 5-bromo-6-chloro-1H-in...

Compound Q&A

What industries use 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4)?

5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4)?

When handling 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4), use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...