Compound Q&A

What industries use 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4)?

Answer

5-Bromo-6-chloro-1H-indol-3-yl octanoate
5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4) is primarily used in the pharmaceutical industry for the development of new drugs. It also has potential applications in the polymer industry for enhancing the properties of polymers, and in the field of sensors for its sensing capabilities under specific conditions.

About

English Name 5-Bromo-6-chloro-1H-indol-3-yl octanoate
Molecular Formula C16H19BrClNO2
Molecular Weight 372.69 g/mol
SMILES CCCCCCCC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl
InChIKey HODNRFUPDHGKHG-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4)?

5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4) has a crystalline form and a molecular w...

Compound Q&A

How is 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4) typically synthesized?

5-Bromo-6-chloro-1H-indol-3-yl octanoate is typically synthesized by reacting 5-bromo-6-chloro-1H-in...

Compound Q&A

What precautions should be taken when handling 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4)?

When handling 5-Bromo-6-chloro-1H-indol-3-yl octanoate (CAS: 209347-94-4), use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...