Compound Q&A

What industries use 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9)?

Answer

1-Fluoro-2-iodo-4-nitrobenzene
1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the production of organic semiconductors and as an intermediate in the development of sensors and polymers. Its unique functional groups make it valuable for a variety of applications in chemical research and development.

About

English Name 1-Fluoro-2-iodo-4-nitrobenzene
Molecular Formula C6H3FINO2
Molecular Weight 266.9964 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])I)F
InChIKey XSFIPDPCQOJJFR-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9)?

1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) is a crystalline solid with a molecular weight of ...

Compound Q&A

How is 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) typically synthesized?

1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) can be synthesized via a multistep process involvi...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9)?

When handling 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9), it is essential to wear appropriate...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...