Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9)?

Answer

1-Fluoro-2-iodo-4-nitrobenzene
1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) is a crystalline solid with a molecular weight of approximately 293.01 g/mol. It has a low solubility in water but is more soluble in common organic solvents like dichloromethane and ethanol. The compound is known for its high reactivity due to the presence of multiple functional groups, making it susceptible to substitution and reduction reactions.

About

English Name 1-Fluoro-2-iodo-4-nitrobenzene
Molecular Formula C6H3FINO2
Molecular Weight 266.9964 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])I)F
InChIKey XSFIPDPCQOJJFR-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) typically synthesized?

1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) can be synthesized via a multistep process involvi...

Compound Q&A

What industries use 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9)?

1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9)?

When handling 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9), it is essential to wear appropriate...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...