Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9)?

Answer

1-Fluoro-2-iodo-4-nitrobenzene
1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) is a crystalline solid with a molecular weight of approximately 293.01 g/mol. It has a low solubility in water but is more soluble in common organic solvents like dichloromethane and ethanol. The compound is known for its high reactivity due to the presence of multiple functional groups, making it susceptible to substitution and reduction reactions.

About

English Name 1-Fluoro-2-iodo-4-nitrobenzene
Molecular Formula C6H3FINO2
Molecular Weight 267 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])I)F
InChIKey XSFIPDPCQOJJFR-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) typically synthesized?

1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) can be synthesized via a multistep process involvi...

Compound Q&A

What industries use 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9)?

1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9) is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9)?

When handling 1-Fluoro-2-iodo-4-nitrobenzene (CAS: 177363-10-9), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...