Compound Q&A

What industries use dichlororuthenium (CAS: 212210-87-2)?

Answer

dichlororuthenium; (1S,2S)-1,2-diphenylethane-1,2-diamine; [1-(2-diphenylphosphanyl-1-naphthyl)-2-naphthyl]-diphenyl-phosphane
Dichlororuthenium (CAS: 212210-87-2) is utilized in various industries, particularly in chemical synthesis, catalysis, and materials science. It plays a crucial role in the development of new materials, pharmaceuticals, and sensors. Its unique properties make it valuable in the production of semiconductors and other advanced technologies.

About

English Name dichlororuthenium; (1S,2S)-1,2-diphenylethane-1,2-diamine; [1-(2-diphenylphosphanyl-1-naphthyl)-2-naphthyl]-diphenyl-phosphane
Molecular Formula C58H48Cl2N2P2Ru
Molecular Weight 1006.96 g/mol
SMILES Cl[Ru]Cl.c8c1ccccc1c(c5c2ccccc2ccc5P(c3ccccc3)c4ccccc4)c(P(c6ccccc6)c7ccccc7)c8.c1ccccc1[C@H](N)[C@@H](N)c2ccccc2
InChIKey PZTVCDSGEXHVBL-LISIALKWSA-L
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of dichlororuthenium (CAS: 212210-87-2)?

Dichlororuthenium (CAS: 212210-87-2) is a complex compound with a molecular weight of approximately ...

Compound Q&A

How is dichlororuthenium (CAS: 212210-87-2) typically synthesized?

Dichlororuthenium (CAS: 212210-87-2) can be synthesized through a multi-step process involving the u...

Compound Q&A

What precautions should be taken when handling dichlororuthenium (CAS: 212210-87-2)?

When handling dichlororuthenium (CAS: 212210-87-2), it is essential to follow proper safety protocol...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...