Compound Q&A

How is dichlororuthenium (CAS: 212210-87-2) typically synthesized?

Answer

dichlororuthenium; (1S,2S)-1,2-diphenylethane-1,2-diamine; [1-(2-diphenylphosphanyl-1-naphthyl)-2-naphthyl]-diphenyl-phosphane
Dichlororuthenium (CAS: 212210-87-2) can be synthesized through a multi-step process involving the use of ruthenium compounds and dichloro reagents. The synthesis typically requires the use of specific catalysts and conditions to achieve high yield and selectivity. Common methods include the use of stoichiometric amounts of dichloro reagents and appropriate solvents.

About

English Name dichlororuthenium; (1S,2S)-1,2-diphenylethane-1,2-diamine; [1-(2-diphenylphosphanyl-1-naphthyl)-2-naphthyl]-diphenyl-phosphane
Molecular Formula C58H48Cl2N2P2Ru
Molecular Weight 1006.96 g/mol
SMILES Cl[Ru]Cl.c8c1ccccc1c(c5c2ccccc2ccc5P(c3ccccc3)c4ccccc4)c(P(c6ccccc6)c7ccccc7)c8.c1ccccc1[C@H](N)[C@@H](N)c2ccccc2
InChIKey PZTVCDSGEXHVBL-LISIALKWSA-L
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of dichlororuthenium (CAS: 212210-87-2)?

Dichlororuthenium (CAS: 212210-87-2) is a complex compound with a molecular weight of approximately ...

Compound Q&A

What industries use dichlororuthenium (CAS: 212210-87-2)?

Dichlororuthenium (CAS: 212210-87-2) is utilized in various industries, particularly in chemical syn...

Compound Q&A

What precautions should be taken when handling dichlororuthenium (CAS: 212210-87-2)?

When handling dichlororuthenium (CAS: 212210-87-2), it is essential to follow proper safety protocol...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...