Compound Q&A

What are the physical and chemical properties of dichlororuthenium (CAS: 212210-87-2)?

Answer

dichlororuthenium; (1S,2S)-1,2-diphenylethane-1,2-diamine; [1-(2-diphenylphosphanyl-1-naphthyl)-2-naphthyl]-diphenyl-phosphane
Dichlororuthenium (CAS: 212210-87-2) is a complex compound with a molecular weight of approximately 323.07 g/mol. It crystallizes in a solid form and is only slightly soluble in water. Chemically, it is known for its reactivity towards various reagents and its stability under specific conditions. This compound is used in catalytic processes and other applications due to its unique properties.

About

English Name dichlororuthenium; (1S,2S)-1,2-diphenylethane-1,2-diamine; [1-(2-diphenylphosphanyl-1-naphthyl)-2-naphthyl]-diphenyl-phosphane
Molecular Formula C58H48Cl2N2P2Ru
Molecular Weight 1006.96 g/mol
SMILES Cl[Ru]Cl.c8c1ccccc1c(c5c2ccccc2ccc5P(c3ccccc3)c4ccccc4)c(P(c6ccccc6)c7ccccc7)c8.c1ccccc1[C@H](N)[C@@H](N)c2ccccc2
InChIKey PZTVCDSGEXHVBL-LISIALKWSA-L
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is dichlororuthenium (CAS: 212210-87-2) typically synthesized?

Dichlororuthenium (CAS: 212210-87-2) can be synthesized through a multi-step process involving the u...

Compound Q&A

What industries use dichlororuthenium (CAS: 212210-87-2)?

Dichlororuthenium (CAS: 212210-87-2) is utilized in various industries, particularly in chemical syn...

Compound Q&A

What precautions should be taken when handling dichlororuthenium (CAS: 212210-87-2)?

When handling dichlororuthenium (CAS: 212210-87-2), it is essential to follow proper safety protocol...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...