Compound Q&A

What industries use 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0)?

Answer

1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid
1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid is widely used in the pharmaceutical industry for the development of novel drugs, particularly in the synthesis of prodrugs and as a building block for peptide and protein synthesis. It also finds applications in the polymer industry, where it serves as a monomer for preparing biodegradable polymers. Additionally, it is used in sensor technology for its ability to form stable complexes with various metal ions and in semiconductor manufacturing due to its specific chemical properties.

About

English Name 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid
Molecular Formula C12H16N2O2
Molecular Weight 220.27 g/mol
SMILES C1CN(CCC1C(=O)O)CC2=CC=NC=C2
InChIKey FQQLUUHEXSHYTO-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0)?

1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid is a crystalline solid with a molecular weight of ...

Compound Q&A

How is 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0) typically synthesized?

1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid can be synthesized via the condensation of 4-piper...

Compound Q&A

What precautions should be taken when handling 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0)?

When handling 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid, it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...