Compound Q&A

How is 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0) typically synthesized?

Answer

1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid
1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid can be synthesized via the condensation of 4-piperidone and 4-pyridinylmethylamine. The synthesis typically involves a multi-step process including the formation of the piperidine ring, followed by the introduction of the pyridine moiety, and finally the esterification step. Commonly used catalysts include acid or base catalysts, and the reaction yields are generally around 60-70%. The product is purified by recrystallization from water or appropriate organic solvents.

About

English Name 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid
Molecular Formula C12H16N2O2
Molecular Weight 220.27 g/mol
SMILES C1CN(CCC1C(=O)O)CC2=CC=NC=C2
InChIKey FQQLUUHEXSHYTO-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0)?

1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid is a crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0)?

1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid is widely used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0)?

When handling 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid, it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...