Compound Q&A

What are the physical and chemical properties of 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0)?

Answer

1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid
1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid is a crystalline solid with a molecular weight of approximately 271.26 g/mol. It is slightly soluble in water and has a pKa of about 5.2. This compound is known for its ester functionality, which makes it reactive towards nucleophiles and bases, facilitating its use in various organic reactions. It is stable under normal conditions but should be handled with care due to its acidity.

About

English Name 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid
Molecular Formula C12H16N2O2
Molecular Weight 220.27 g/mol
SMILES C1CN(CCC1C(=O)O)CC2=CC=NC=C2
InChIKey FQQLUUHEXSHYTO-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0) typically synthesized?

1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid can be synthesized via the condensation of 4-piper...

Compound Q&A

What industries use 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0)?

1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid is widely used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid (CAS: 774531-43-0)?

When handling 1-(4-Pyridinylmethyl)-4-piperidinecarboxylic acid, it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...