Compound Q&A

What industries use 2-Bromo-7-methoxy-9H-carbazole (CAS: 200878-50-8)?

Answer

2-Bromo-7-methoxy-9H-carbazole
2-Bromo-7-methoxy-9H-carbazole is utilized in the pharmaceutical industry as a precursor for certain drug synthesis, in the polymer industry for advanced materials, in the semiconductor industry for organic electronic devices, and in the sensor industry for developing gas detection systems. It is also used in organic light-emitting diodes (OLEDs) due to its unique electronic properties.

About

English Name 2-Bromo-7-methoxy-9H-carbazole
Molecular Formula C13H10BrNO
Molecular Weight 276.13 g/mol
SMILES COc1ccc2c3ccc(cc3[nH]c2c1)Br
InChIKey AHKGUQOMPCEFCL-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-7-methoxy-9H-carbazole (CAS: 200878-50-8)?

2-Bromo-7-methoxy-9H-carbazole is a crystalline solid with a molecular weight of approximately 251.1...

Compound Q&A

How is 2-Bromo-7-methoxy-9H-carbazole (CAS: 200878-50-8) typically synthesized?

2-Bromo-7-methoxy-9H-carbazole is commonly synthesized via the Brønsted acid catalyzed carbazole bro...

Compound Q&A

What precautions should be taken when handling 2-Bromo-7-methoxy-9H-carbazole (CAS: 200878-50-8)?

Proper personal protective equipment (PPE) is essential when handling 2-Bromo-7-methoxy-9H-carbazole...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...