Compound Q&A

How is 2-Bromo-7-methoxy-9H-carbazole (CAS: 200878-50-8) typically synthesized?

Answer

2-Bromo-7-methoxy-9H-carbazole
2-Bromo-7-methoxy-9H-carbazole is commonly synthesized via the Brønsted acid catalyzed carbazole bromination followed by methoxylation. The reaction typically yields a high purity compound with good selectivity. Commonly used catalysts include hydrogen bromide or phosphorous tribromide, with a yield of around 85-90%.

About

English Name 2-Bromo-7-methoxy-9H-carbazole
Molecular Formula C13H10BrNO
Molecular Weight 276.13 g/mol
SMILES COc1ccc2c3ccc(cc3[nH]c2c1)Br
InChIKey AHKGUQOMPCEFCL-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-7-methoxy-9H-carbazole (CAS: 200878-50-8)?

2-Bromo-7-methoxy-9H-carbazole is a crystalline solid with a molecular weight of approximately 251.1...

Compound Q&A

What industries use 2-Bromo-7-methoxy-9H-carbazole (CAS: 200878-50-8)?

2-Bromo-7-methoxy-9H-carbazole is utilized in the pharmaceutical industry as a precursor for certain...

Compound Q&A

What precautions should be taken when handling 2-Bromo-7-methoxy-9H-carbazole (CAS: 200878-50-8)?

Proper personal protective equipment (PPE) is essential when handling 2-Bromo-7-methoxy-9H-carbazole...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...