Compound Q&A

What industries use 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS: 18735-74-5)?

Answer

5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid
5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in polymer production, particularly in the development of functional polymers. Additionally, it is used in the fabrication of chemical sensors and semiconductors due to its unique chemical properties.

About

CAS No 18735-74-5
English Name 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid
Molecular Formula C11H9NO3
Molecular Weight 203.2 g/mol
SMILES CC1=C(N=C(O1)C2=CC=CC=C2)C(=O)O
InChIKey YABCPNYCFFUVNM-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS: 18735-74-5)?

5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid is a white crystalline solid with a molecular weight...

Compound Q&A

How is 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS: 18735-74-5) typically synthesized?

5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid is synthesized through a multi-step process involvin...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS: 18735-74-5)?

When handling 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid, it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...