Compound Q&A

How is 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS: 18735-74-5) typically synthesized?

Answer

5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid
5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid is synthesized through a multi-step process involving the condensation of 2-phenyl-1,3-oxazole with acetic anhydride followed by hydrolysis. The reaction is catalyzed by a suitable acid to enhance selectivity and yield, typically around 85-90%.

About

CAS No 18735-74-5
English Name 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid
Molecular Formula C11H9NO3
Molecular Weight 203.2 g/mol
SMILES CC1=C(N=C(O1)C2=CC=CC=C2)C(=O)O
InChIKey YABCPNYCFFUVNM-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS: 18735-74-5)?

5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid is a white crystalline solid with a molecular weight...

Compound Q&A

What industries use 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS: 18735-74-5)?

5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid (CAS: 18735-74-5)?

When handling 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid, it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...