Compound Q&A

What industries use Bacopaside V (CAS: 620592-16-7)?

Answer

Bacopaside V
Bacopaside V (CAS: 620592-16-7) is primarily used in the pharmaceutical industry for its potential health benefits, such as cognitive enhancement and neuroprotection. It is also explored in the sensor industry for its optical properties and in the semiconductor industry for its electronic properties.

About

English Name Bacopaside V
Molecular Formula C41H66O13
Molecular Weight 766.96 g/mol
SMILES CC(C)=CC1CC(C)(O)C2C3CCC4C5(C)CCC(OC6OCC(O)C(OC7OC(CO)C(O)C(O)C7O)C6O)C(C)(C)C5CCC4(C)C34COC2(C4)O1
InChIKey YMACEWFCLOFSBZ-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bacopaside V (CAS: 620592-16-7)?

Bacopaside V is a white to off-white crystalline compound (CAS: 620592-16-7) with a molecular weight...

Compound Q&A

How is Bacopaside V (CAS: 620592-16-7) typically synthesized?

Bacopaside V is typically synthesized via a multistep process starting from saponin derivatives, com...

Compound Q&A

What precautions should be taken when handling Bacopaside V (CAS: 620592-16-7)?

When handling Bacopaside V (CAS: 620592-16-7), wear appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...