Compound Q&A

How is Bacopaside V (CAS: 620592-16-7) typically synthesized?

Answer

Bacopaside V
Bacopaside V is typically synthesized via a multistep process starting from saponin derivatives, commonly using cyclization and reduction reactions. Key steps include the conversion of saponin to an acetylenic intermediate, followed by ring closure and reduction with sodium borohydride. The overall yield is moderate, around 50-70%, with selectivity towards the desired product.

About

English Name Bacopaside V
Molecular Formula C41H66O13
Molecular Weight 766.96 g/mol
SMILES CC(C)=CC1CC(C)(O)C2C3CCC4C5(C)CCC(OC6OCC(O)C(OC7OC(CO)C(O)C(O)C7O)C6O)C(C)(C)C5CCC4(C)C34COC2(C4)O1
InChIKey YMACEWFCLOFSBZ-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bacopaside V (CAS: 620592-16-7)?

Bacopaside V is a white to off-white crystalline compound (CAS: 620592-16-7) with a molecular weight...

Compound Q&A

What industries use Bacopaside V (CAS: 620592-16-7)?

Bacopaside V (CAS: 620592-16-7) is primarily used in the pharmaceutical industry for its potential h...

Compound Q&A

What precautions should be taken when handling Bacopaside V (CAS: 620592-16-7)?

When handling Bacopaside V (CAS: 620592-16-7), wear appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...