Compound Q&A

What are the physical and chemical properties of Bacopaside V (CAS: 620592-16-7)?

Answer

Bacopaside V
Bacopaside V is a white to off-white crystalline compound (CAS: 620592-16-7) with a molecular weight of approximately 734.5 g/mol. It has poor water solubility and is soluble in organic solvents like methanol and ethanol. Chemically, it is relatively stable but can undergo mild oxidative degradation under alkaline conditions. It has limited reactivity under normal temperature and pressure conditions.

About

English Name Bacopaside V
Molecular Formula C41H66O13
Molecular Weight 766.96 g/mol
SMILES CC(C)=CC1CC(C)(O)C2C3CCC4C5(C)CCC(OC6OCC(O)C(OC7OC(CO)C(O)C(O)C7O)C6O)C(C)(C)C5CCC4(C)C34COC2(C4)O1
InChIKey YMACEWFCLOFSBZ-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is Bacopaside V (CAS: 620592-16-7) typically synthesized?

Bacopaside V is typically synthesized via a multistep process starting from saponin derivatives, com...

Compound Q&A

What industries use Bacopaside V (CAS: 620592-16-7)?

Bacopaside V (CAS: 620592-16-7) is primarily used in the pharmaceutical industry for its potential h...

Compound Q&A

What precautions should be taken when handling Bacopaside V (CAS: 620592-16-7)?

When handling Bacopaside V (CAS: 620592-16-7), wear appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...