Compound Q&A

What precautions should be taken when handling (2-Cyclopropylpyrimidin-5-yl)boronic acid (CAS: 893567-15-2)?

Answer

(2-Cyclopropylpyrimidin-5-yl)boronic acid
When handling (2-Cyclopropylpyrimidin-5-yl)boronic acid, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a dry, cool place away from strong oxidizing agents. In case of a spill, use appropriate spill cleanup materials and consult the Safety Data Sheet (SDS) for detailed instructions. The fume hood should be used during handling to minimize exposure to volatile compounds.

About

English Name (2-Cyclopropylpyrimidin-5-yl)boronic acid
Molecular Formula C7H9BN2O2
Molecular Weight 163.97 g/mol
SMILES B(C1=CN=C(N=C1)C2CC2)(O)O
InChIKey HIBBMEFTPMTWOY-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Cyclopropylpyrimidin-5-yl)boronic acid (CAS: 893567-15-2)?

(2-Cyclopropylpyrimidin-5-yl)boronic acid has a crystalline form and a molecular weight of approxima...

Compound Q&A

How is (2-Cyclopropylpyrimidin-5-yl)boronic acid (CAS: 893567-15-2) typically synthesized?

(2-Cyclopropylpyrimidin-5-yl)boronic acid can be synthesized through the coupling of 2-cyclopropylpy...

Compound Q&A

What industries use (2-Cyclopropylpyrimidin-5-yl)boronic acid (CAS: 893567-15-2)?

(2-Cyclopropylpyrimidin-5-yl)boronic acid is primarily used in the pharmaceutical industry, where it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...