Compound Q&A

How is (2-Cyclopropylpyrimidin-5-yl)boronic acid (CAS: 893567-15-2) typically synthesized?

Answer

(2-Cyclopropylpyrimidin-5-yl)boronic acid
(2-Cyclopropylpyrimidin-5-yl)boronic acid can be synthesized through the coupling of 2-cyclopropylpyrimidine-5-boronic acid pinacol ester with a suitable boronic ester in the presence of a palladium catalyst and a base. Commonly, tris(dibenzylideneacetone)dipalladium(0) and tri-ortho-tolylphosphine are used as catalysts, and potassium carbonate or sodium carbonate as the base. The reaction typically shows high selectivity and yield.

About

English Name (2-Cyclopropylpyrimidin-5-yl)boronic acid
Molecular Formula C7H9BN2O2
Molecular Weight 163.97 g/mol
SMILES B(C1=CN=C(N=C1)C2CC2)(O)O
InChIKey HIBBMEFTPMTWOY-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Cyclopropylpyrimidin-5-yl)boronic acid (CAS: 893567-15-2)?

(2-Cyclopropylpyrimidin-5-yl)boronic acid has a crystalline form and a molecular weight of approxima...

Compound Q&A

What industries use (2-Cyclopropylpyrimidin-5-yl)boronic acid (CAS: 893567-15-2)?

(2-Cyclopropylpyrimidin-5-yl)boronic acid is primarily used in the pharmaceutical industry, where it...

Compound Q&A

What precautions should be taken when handling (2-Cyclopropylpyrimidin-5-yl)boronic acid (CAS: 893567-15-2)?

When handling (2-Cyclopropylpyrimidin-5-yl)boronic acid, it is essential to use personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...