Compound Q&A

What precautions should be taken when handling gasoline (CAS: 8006-61-9)?

Answer

gasoline
Handling gasoline (CAS: 8006-61-9) requires strict safety measures. Use proper personal protective equipment (PPE) such as gloves, goggles, and appropriate clothing. Work in a well-ventilated area or a fume hood. Store gasoline in a cool, dry place away from ignition sources. In case of spills, immediately contain and clean up using appropriate absorbents. Always refer to the Safety Data Sheet (SDS) for specific safety guidelines.

About

CAS No 8006-61-9
English Name gasoline
Molecular Formula C13H9NO3
Molecular Weight 227.22 g/mol
EINECS 232-349-1
SMILES O1C(C(=O)O)=C(C2C=CC=CC1=2)N1C=CC=C1
InChIKey YCTXQBNFNACZHO-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of gasoline (CAS: 8006-61-9)?

Gasoline (CAS: 8006-61-9) is a complex mixture of hydrocarbons with a typical molecular weight range...

Compound Q&A

How is gasoline (CAS: 8006-61-9) typically synthesized?

Gasoline is typically synthesized through the fractional distillation of crude oil, followed by cata...

Compound Q&A

What industries use gasoline (CAS: 8006-61-9)?

Gasoline (CAS: 8006-61-9) is widely used in the transportation industry as a fuel for conventional g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...