Compound Q&A

What are the physical and chemical properties of gasoline (CAS: 8006-61-9)?

Answer

gasoline
Gasoline (CAS: 8006-61-9) is a complex mixture of hydrocarbons with a typical molecular weight range of 86 to 114. It has a low boiling point, ranging from 30 to 205°C, and is highly flammable. Gasoline is slightly soluble in water but is more soluble in ethanol. It is reactive with strong oxidizers and halogens. Its high reactivity and flammability make it a hazardous material.

About

CAS No 8006-61-9
English Name gasoline
Molecular Formula C13H9NO3
Molecular Weight 227.22 g/mol
EINECS 232-349-1
SMILES O1C(C(=O)O)=C(C2C=CC=CC1=2)N1C=CC=C1
InChIKey YCTXQBNFNACZHO-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is gasoline (CAS: 8006-61-9) typically synthesized?

Gasoline is typically synthesized through the fractional distillation of crude oil, followed by cata...

Compound Q&A

What industries use gasoline (CAS: 8006-61-9)?

Gasoline (CAS: 8006-61-9) is widely used in the transportation industry as a fuel for conventional g...

Compound Q&A

What precautions should be taken when handling gasoline (CAS: 8006-61-9)?

Handling gasoline (CAS: 8006-61-9) requires strict safety measures. Use proper personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...