Compound Q&A

How is gasoline (CAS: 8006-61-9) typically synthesized?

Answer

gasoline
Gasoline is typically synthesized through the fractional distillation of crude oil, followed by catalytic reforming and isomerization processes. These methods yield gasoline with specific octane ratings and boiling point ranges. Catalysts such as platinum and rhenium are used in reforming to increase the yield of high-octane components. The process also involves cracking heavy hydrocarbons into lighter ones.

About

CAS No 8006-61-9
English Name gasoline
Molecular Formula C13H9NO3
Molecular Weight 227.22 g/mol
EINECS 232-349-1
SMILES O1C(C(=O)O)=C(C2C=CC=CC1=2)N1C=CC=C1
InChIKey YCTXQBNFNACZHO-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of gasoline (CAS: 8006-61-9)?

Gasoline (CAS: 8006-61-9) is a complex mixture of hydrocarbons with a typical molecular weight range...

Compound Q&A

What industries use gasoline (CAS: 8006-61-9)?

Gasoline (CAS: 8006-61-9) is widely used in the transportation industry as a fuel for conventional g...

Compound Q&A

What precautions should be taken when handling gasoline (CAS: 8006-61-9)?

Handling gasoline (CAS: 8006-61-9) requires strict safety measures. Use proper personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...