Compound Q&A

What industries use Methyl 3-chloro-5-nitrobenzoate (CAS: 36138-28-0)?

Answer

Methyl 3-chloro-5-nitrobenzoate
Methyl 3-chloro-5-nitrobenzoate is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those requiring specific functional groups. It is also utilized in the polymer industry for the preparation of special polymers and in the sensor industry for developing gas sensing materials. Additionally, it has applications in semiconductor technology as a precursor for certain compounds.

About

CAS No 36138-28-0
English Name Methyl 3-chloro-5-nitrobenzoate
Molecular Formula C8H6ClNO4
Molecular Weight 215.59 g/mol
SMILES COC(=O)C1=CC(=CC(=C1)Cl)[N+](=O)[O-]
InChIKey UYQJTXQJNZMDBI-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-chloro-5-nitrobenzoate (CAS: 36138-28-0)?

Methyl 3-chloro-5-nitrobenzoate has a crystalline form and a molecular weight of approximately 240.0...

Compound Q&A

How is Methyl 3-chloro-5-nitrobenzoate (CAS: 36138-28-0) typically synthesized?

Methyl 3-chloro-5-nitrobenzoate can be synthesized via nitration of methyl benzoate followed by chlo...

Compound Q&A

What precautions should be taken when handling Methyl 3-chloro-5-nitrobenzoate (CAS: 36138-28-0)?

When handling Methyl 3-chloro-5-nitrobenzoate, it is essential to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...