Compound Q&A

How is Methyl 3-chloro-5-nitrobenzoate (CAS: 36138-28-0) typically synthesized?

Answer

Methyl 3-chloro-5-nitrobenzoate
Methyl 3-chloro-5-nitrobenzoate can be synthesized via nitration of methyl benzoate followed by chlorination. Commonly, the nitration is performed using nitric acid and sulfuric acid mixture, and chlorination is achieved using thionyl chloride. The overall process involves careful control of temperature and concentration to achieve high yield and selectivity.

About

CAS No 36138-28-0
English Name Methyl 3-chloro-5-nitrobenzoate
Molecular Formula C8H6ClNO4
Molecular Weight 215.59 g/mol
SMILES COC(=O)C1=CC(=CC(=C1)Cl)[N+](=O)[O-]
InChIKey UYQJTXQJNZMDBI-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-chloro-5-nitrobenzoate (CAS: 36138-28-0)?

Methyl 3-chloro-5-nitrobenzoate has a crystalline form and a molecular weight of approximately 240.0...

Compound Q&A

What industries use Methyl 3-chloro-5-nitrobenzoate (CAS: 36138-28-0)?

Methyl 3-chloro-5-nitrobenzoate is used in the pharmaceutical industry for the synthesis of certain ...

Compound Q&A

What precautions should be taken when handling Methyl 3-chloro-5-nitrobenzoate (CAS: 36138-28-0)?

When handling Methyl 3-chloro-5-nitrobenzoate, it is essential to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...