Compound Q&A

What industries use N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6)?

Answer

N,N-Bis(4-aminophenyl)-1,4-benzenediamine
N,N-Bis(4-aminophenyl)-1,4-benzenediamine is primarily used in the pharmaceutical and polymer industries. In pharmaceuticals, it serves as a precursor for the synthesis of biologically active compounds. In polymers, it acts as a stabilizer and crosslinking agent, enhancing material properties. It also finds applications in the production of sensors and semiconductors due to its electronic properties.

About

CAS No 25321-14-6
English Name N,N-Bis(4-aminophenyl)-1,4-benzenediamine
Molecular Formula C18H18N4
Molecular Weight 290.37 g/mol
SMILES CC1=C(C(=CC=C1)[N+](=O)[O-])[N+](=O)[O-]
InChIKey SNLFYGIUTYKKOE-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6)?

N,N-Bis(4-aminophenyl)-1,4-benzenediamine is a solid, crystalline compound with a molecular weight o...

Compound Q&A

How is N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6) typically synthesized?

N,N-Bis(4-aminophenyl)-1,4-benzenediamine is synthesized by a multi-step process involving the coupl...

Compound Q&A

What precautions should be taken when handling N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6)?

When handling N,N-Bis(4-aminophenyl)-1,4-benzenediamine, it is essential to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...