Compound Q&A

How is N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6) typically synthesized?

Answer

N,N-Bis(4-aminophenyl)-1,4-benzenediamine
N,N-Bis(4-aminophenyl)-1,4-benzenediamine is synthesized by a multi-step process involving the coupling of 4-aminophenol with 1,4-benzenediamine. The reaction is typically carried out in an aqueous medium with a catalyst such as sodium carbonate or potassium carbonate, leading to high yield and selectivity. This process requires careful temperature and pH control to ensure efficient coupling and product purity.

About

CAS No 25321-14-6
English Name N,N-Bis(4-aminophenyl)-1,4-benzenediamine
Molecular Formula C18H18N4
Molecular Weight 290.37 g/mol
SMILES CC1=C(C(=CC=C1)[N+](=O)[O-])[N+](=O)[O-]
InChIKey SNLFYGIUTYKKOE-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6)?

N,N-Bis(4-aminophenyl)-1,4-benzenediamine is a solid, crystalline compound with a molecular weight o...

Compound Q&A

What industries use N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6)?

N,N-Bis(4-aminophenyl)-1,4-benzenediamine is primarily used in the pharmaceutical and polymer indust...

Compound Q&A

What precautions should be taken when handling N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6)?

When handling N,N-Bis(4-aminophenyl)-1,4-benzenediamine, it is essential to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...