Compound Q&A

What are the physical and chemical properties of N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6)?

Answer

N,N-Bis(4-aminophenyl)-1,4-benzenediamine
N,N-Bis(4-aminophenyl)-1,4-benzenediamine is a solid, crystalline compound with a molecular weight of approximately 220.23 g/mol. It has a low solubility in water but is more soluble in organic solvents. Chemically, it is highly reactive due to its amine groups, making it suitable for various organic reactions. It exhibits basic properties due to these amines and can participate in proton transfer reactions.

About

CAS No 25321-14-6
English Name N,N-Bis(4-aminophenyl)-1,4-benzenediamine
Molecular Formula C18H18N4
Molecular Weight 290.37 g/mol
SMILES CC1=C(C(=CC=C1)[N+](=O)[O-])[N+](=O)[O-]
InChIKey SNLFYGIUTYKKOE-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6) typically synthesized?

N,N-Bis(4-aminophenyl)-1,4-benzenediamine is synthesized by a multi-step process involving the coupl...

Compound Q&A

What industries use N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6)?

N,N-Bis(4-aminophenyl)-1,4-benzenediamine is primarily used in the pharmaceutical and polymer indust...

Compound Q&A

What precautions should be taken when handling N,N-Bis(4-aminophenyl)-1,4-benzenediamine (CAS: 25321-14-6)?

When handling N,N-Bis(4-aminophenyl)-1,4-benzenediamine, it is essential to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...