Compound Q&A

What industries use (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2)?

Answer

(5-Acetamido-2-nitrophenyl)boronic acid
(5-Acetamido-2-nitrophenyl)boronic acid is utilized in various industries, including pharmaceuticals, where it serves as a precursor in drug synthesis. In polymers, it can enhance properties such as thermal stability. It is also employed in sensor technology for detecting specific compounds and in semiconductor manufacturing for photoresist applications. Its versatile functionality makes it a valuable reagent in organic synthesis.

About

CAS No 78887-36-2
English Name (5-Acetamido-2-nitrophenyl)boronic acid
Molecular Formula C8H9BN2O5
Molecular Weight 223.98 g/mol
SMILES B(C1=C(C=CC(=C1)NC(=O)C)[N+](=O)[O-])(O)O
InChIKey VDKGDBOETDSECW-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2)?

(5-Acetamido-2-nitrophenyl)boronic acid is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2) typically synthesized?

(5-Acetamido-2-nitrophenyl)boronic acid can be synthesized via a multi-step process starting with 2-...

Compound Q&A

What precautions should be taken when handling (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2)?

When handling (5-Acetamido-2-nitrophenyl)boronic acid, it is important to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...