Compound Q&A

What are the physical and chemical properties of (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2)?

Answer

(5-Acetamido-2-nitrophenyl)boronic acid
(5-Acetamido-2-nitrophenyl)boronic acid is a crystalline compound with a molecular weight of approximately 265.12 g/mol. It is slightly soluble in water and ethanol, and exhibits moderate reactivity towards nucleophiles. This compound is stable under normal conditions but can degrade under strongly acidic or basic conditions. It is often used in organic synthesis and biochemistry due to its boronic acid functionality.

About

CAS No 78887-36-2
English Name (5-Acetamido-2-nitrophenyl)boronic acid
Molecular Formula C8H9BN2O5
Molecular Weight 223.98 g/mol
SMILES B(C1=C(C=CC(=C1)NC(=O)C)[N+](=O)[O-])(O)O
InChIKey VDKGDBOETDSECW-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2) typically synthesized?

(5-Acetamido-2-nitrophenyl)boronic acid can be synthesized via a multi-step process starting with 2-...

Compound Q&A

What industries use (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2)?

(5-Acetamido-2-nitrophenyl)boronic acid is utilized in various industries, including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2)?

When handling (5-Acetamido-2-nitrophenyl)boronic acid, it is important to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...