Compound Q&A

How is (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2) typically synthesized?

Answer

(5-Acetamido-2-nitrophenyl)boronic acid
(5-Acetamido-2-nitrophenyl)boronic acid can be synthesized via a multi-step process starting with 2-nitrophenol and acetic anhydride. The synthesis involves esterification followed by reduction of the nitro group to an amino group. Boronate ester formation is achieved using a boronate pinacol ester reagent. This method provides high yield and good selectivity for the desired product.

About

CAS No 78887-36-2
English Name (5-Acetamido-2-nitrophenyl)boronic acid
Molecular Formula C8H9BN2O5
Molecular Weight 223.98 g/mol
SMILES B(C1=C(C=CC(=C1)NC(=O)C)[N+](=O)[O-])(O)O
InChIKey VDKGDBOETDSECW-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2)?

(5-Acetamido-2-nitrophenyl)boronic acid is a crystalline compound with a molecular weight of approxi...

Compound Q&A

What industries use (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2)?

(5-Acetamido-2-nitrophenyl)boronic acid is utilized in various industries, including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling (5-Acetamido-2-nitrophenyl)boronic acid (CAS: 78887-36-2)?

When handling (5-Acetamido-2-nitrophenyl)boronic acid, it is important to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...