Compound Q&A

What precautions should be taken when handling [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8)?

Answer

[4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid
When handling [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8), it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. The compound should be managed in a well-ventilated area, preferably in a fume hood, to minimize inhalation risks. Spills should be cleaned up immediately using appropriate spill kits, and proper disposal methods should be followed. For detailed safety information, refer to the Material Safety Data Sheet (MSDS/SDS).

About

English Name [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid
Molecular Formula C11H12N2O3
Molecular Weight 220.23 g/mol
SMILES O=C(O)CC1=CC=C(N2CCNC2=O)C=C1
InChIKey SAUIBPUGJQBOSH-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8)?

The compound [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) is a crystalline solid...

Compound Q&A

How is [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) typically synthesized?

The compound [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) can be synthesized via...

Compound Q&A

What industries use [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8)?

The compound [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) is primarily used in t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...