Compound Q&A

What are the physical and chemical properties of [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8)?

Answer

[4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid
The compound [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) is a crystalline solid with a molecular weight of approximately 245.23 g/mol. It has a pKa value of about 3.9 and is soluble in common organic solvents such as methanol and acetone. It is less soluble in water. The compound is relatively stable under normal conditions but can react with bases to form the corresponding salt.

About

English Name [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid
Molecular Formula C11H12N2O3
Molecular Weight 220.23 g/mol
SMILES O=C(O)CC1=CC=C(N2CCNC2=O)C=C1
InChIKey SAUIBPUGJQBOSH-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) typically synthesized?

The compound [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) can be synthesized via...

Compound Q&A

What industries use [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8)?

The compound [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) is primarily used in t...

Compound Q&A

What precautions should be taken when handling [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8)?

When handling [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...