Compound Q&A

What industries use [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8)?

Answer

[4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid
The compound [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in the polymer industry, where it can be used as a monomer. Additionally, it has potential uses in the development of sensors and semiconductors due to its chemical reactivity and functional groups.

About

English Name [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid
Molecular Formula C11H12N2O3
Molecular Weight 220.23 g/mol
SMILES O=C(O)CC1=CC=C(N2CCNC2=O)C=C1
InChIKey SAUIBPUGJQBOSH-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8)?

The compound [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) is a crystalline solid...

Compound Q&A

How is [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) typically synthesized?

The compound [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8) can be synthesized via...

Compound Q&A

What precautions should be taken when handling [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8)?

When handling [4-(2-Oxo-1-imidazolidinyl)phenyl]acetic acid (CAS: 492445-92-8), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...