Compound Q&A

What industries use Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate (CAS: 171722-92-2)?

Answer

Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate
Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate is used primarily in the pharmaceutical industry for its potential as a precursor in drug synthesis. It may also find applications in the development of sensors and as a component in certain polymer formulations. Due to its specific chemical properties, it is less commonly used in semiconductors or other industries.

About

English Name Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate
Molecular Formula C18H20N2O2
Molecular Weight 296.37 g/mol
SMILES C1CNCCC1OC(=O)NC2=CC=CC=C2C3=CC=CC=C3
InChIKey AGZCCVMWUZINGV-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate (CAS: 171722-92-2)?

Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate is a solid with a crystalline form. Its molecular weigh...

Compound Q&A

How is Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate (CAS: 171722-92-2) typically synthesized?

Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate is typically synthesized through a multi-step process i...

Compound Q&A

What precautions should be taken when handling Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate (CAS: 171722-92-2)?

When handling Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate, it is crucial to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...