Compound Q&A

What are the physical and chemical properties of Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate (CAS: 171722-92-2)?

Answer

Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate
Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate is a solid with a crystalline form. Its molecular weight is approximately 332.37 g/mol. The compound is slightly soluble in water but has good solubility in common organic solvents like methanol and dichloromethane. It is chemically stable but can react with strong acids or bases. It is important to handle this compound under anhydrous conditions to prevent hydrolysis.

About

English Name Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate
Molecular Formula C18H20N2O2
Molecular Weight 296.37 g/mol
SMILES C1CNCCC1OC(=O)NC2=CC=CC=C2C3=CC=CC=C3
InChIKey AGZCCVMWUZINGV-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate (CAS: 171722-92-2) typically synthesized?

Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate is typically synthesized through a multi-step process i...

Compound Q&A

What industries use Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate (CAS: 171722-92-2)?

Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate is used primarily in the pharmaceutical industry for it...

Compound Q&A

What precautions should be taken when handling Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate (CAS: 171722-92-2)?

When handling Piperidin-4-yl [1,1'-biphenyl]-2-ylcarbamate, it is crucial to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...