Compound Q&A

What industries use (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2)?

Answer

(2S)-3-Methyl-2-phenylbutanoic acid
(2S)-3-Methyl-2-phenylbutanoic acid finds applications in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for modifying properties of polymers, and in the sensor industry for developing chemical sensors. It is also used in the semiconductor industry as a chemical intermediate.

About

CAS No 13490-69-2
English Name (2S)-3-Methyl-2-phenylbutanoic acid
Molecular Formula C11H14O2
Molecular Weight 178.23 g/mol
SMILES CC([C@@H](c1ccccc1)C(=O)O)C
InChIKey HDLQGISFYDYWFJ-JTQLQIEISA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2)?

(2S)-3-Methyl-2-phenylbutanoic acid is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

How is (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2) typically synthesized?

(2S)-3-Methyl-2-phenylbutanoic acid can be synthesized via several routes, including the Knoevenagel...

Compound Q&A

What precautions should be taken when handling (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2)?

When handling (2S)-3-Methyl-2-phenylbutanoic acid, use personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...