Compound Q&A

What are the physical and chemical properties of (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2)?

Answer

(2S)-3-Methyl-2-phenylbutanoic acid
(2S)-3-Methyl-2-phenylbutanoic acid is a white crystalline solid with a molecular weight of approximately 188.24 g/mol. It has a melting point of about 78-80°C and is slightly soluble in water. This compound is reactive and can undergo esterification and amide formation. It is also susceptible to hydrolysis under acidic or basic conditions.

About

CAS No 13490-69-2
English Name (2S)-3-Methyl-2-phenylbutanoic acid
Molecular Formula C11H14O2
Molecular Weight 178.23 g/mol
SMILES CC([C@@H](c1ccccc1)C(=O)O)C
InChIKey HDLQGISFYDYWFJ-JTQLQIEISA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2) typically synthesized?

(2S)-3-Methyl-2-phenylbutanoic acid can be synthesized via several routes, including the Knoevenagel...

Compound Q&A

What industries use (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2)?

(2S)-3-Methyl-2-phenylbutanoic acid finds applications in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2)?

When handling (2S)-3-Methyl-2-phenylbutanoic acid, use personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...